C20H24N4 — CID 91938177
N',N'-diethyl-N-(2-pyridin-2-ylquinolin-4-yl)ethane-1,2-diamine (PubChem CID 91938177) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is N',N'-diethyl-N-(2-pyridin-2-ylquinolin-4-yl)ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-(2-pyridin-2-ylquinolin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 91938177 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | N',N'-diethyl-N-(2-pyridin-2-ylquinolin-4-yl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1cc(-c2ccccn2)nc2ccccc12 |
| InChI | InChI=1S/C20H24N4/c1-3-24(4-2)14-13-22-19-15-20(18-11-7-8-12-21-18)23-17-10-6-5-9-16(17)19/h5-12,15H,3-4,13-14H2,1-2H3,(H,22,23) |
| InChIKey | MRIJKLVVCLDGQH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |