C15H17ClN4O — CID 91938627
[5-chloro-1-[(4-methylphenyl)methyl]triazol-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 91938627) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is [5-chloro-1-[(4-methylphenyl)methyl]triazol-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-chloro-1-[(4-methylphenyl)methyl]triazol-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 91938627 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | [5-chloro-1-[(4-methylphenyl)methyl]triazol-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1ccc(Cn2nnc(C(=O)N3CCCC3)c2Cl)cc1 |
| InChI | InChI=1S/C15H17ClN4O/c1-11-4-6-12(7-5-11)10-20-14(16)13(17-18-20)15(21)19-8-2-3-9-19/h4-7H,2-3,8-10H2,1H3 |
| InChIKey | PYKXDWXPRYEYCP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |