C16H17N3O5 — CID 91938956
methyl 2-[[2-(4-methoxy-6-oxo-3-phenylpyridazin-1-yl)acetyl]amino]acetate (PubChem CID 91938956) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is methyl 2-[[2-(4-methoxy-6-oxo-3-phenylpyridazin-1-yl)acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-(4-methoxy-6-oxo-3-phenylpyridazin-1-yl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 91938956 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | methyl 2-[[2-(4-methoxy-6-oxo-3-phenylpyridazin-1-yl)acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)Cn1nc(-c2ccccc2)c(OC)cc1=O |
| InChI | InChI=1S/C16H17N3O5/c1-23-12-8-14(21)19(10-13(20)17-9-15(22)24-2)18-16(12)11-6-4-3-5-7-11/h3-8H,9-10H2,1-2H3,(H,17,20) |
| InChIKey | JLRNOGRWKJCGDP-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |