C20H16FN3OS2 — CID 91939242
N-[[6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl]methyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 91939242) has the molecular formula C20H16FN3OS2 and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[[6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl]methyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[[6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl]methyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 91939242 |
| Molecular Formula | C20H16FN3OS2 |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-[[6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazol-2-yl]methyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | Cc1c(CNC(=O)C=Cc2cccs2)sc2nc(-c3ccc(F)cc3)cn12 |
| InChI | InChI=1S/C20H16FN3OS2/c1-13-18(11-22-19(25)9-8-16-3-2-10-26-16)27-20-23-17(12-24(13)20)14-4-6-15(21)7-5-14/h2-10,12H,11H2,1H3,(H,22,25) |
| InChIKey | FPWWQGKJBWSZSL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|