C29H30N2O3S — CID 91939938
N-[[4-(2,3-dihydro-1H-inden-2-yloxy)phenyl]methyl]-N-[(3S)-2-oxoazepan-3-yl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 91939938) has the molecular formula C29H30N2O3S and a molecular weight of 486.64 g/mol. Its IUPAC name is N-[[4-(2,3-dihydro-1H-inden-2-yloxy)phenyl]methyl]-N-[(3S)-2-oxoazepan-3-yl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[[4-(2,3-dihydro-1H-inden-2-yloxy)phenyl]methyl]-N-[(3S)-2-oxoazepan-3-yl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 91939938 |
| Molecular Formula | C29H30N2O3S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | N-[[4-(2,3-dihydro-1H-inden-2-yloxy)phenyl]methyl]-N-[(3S)-2-oxoazepan-3-yl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C1NCCCC[C@@H]1N(Cc1ccc(OC2Cc3ccccc3C2)cc1)C(=O)C=Cc1cccs1 |
| InChI | InChI=1S/C29H30N2O3S/c32-28(15-14-26-8-5-17-35-26)31(27-9-3-4-16-30-29(27)33)20-21-10-12-24(13-11-21)34-25-18-22-6-1-2-7-23(22)19-25/h1-2,5-8,10-15,17,25,27H,3-4,9,16,18-20H2,(H,30,33)/t27-/m0/s1 |
| InChIKey | GSPRRBVKCWNTKG-MHZLTWQESA-N |
| XLogP | 5.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|