About 2-cyclopentyl-N-[[(2S,4S)-4-fluoro-1-pent-3-enoylpyrrolidin-2-yl]methyl]acetamide
2-cyclopentyl-N-[[(2S,4S)-4-fluoro-1-pent-3-enoylpyrrolidin-2-yl]methyl]acetamide (PubChem CID 91940174) has the molecular formula C17H27FN2O2
and a molecular weight of 310.41 g/mol. Its IUPAC name is 2-cyclopentyl-N-[[(2S,4S)-4-fluoro-1-pent-3-enoylpyrrolidin-2-yl]methyl]acetamide.
Molecular Properties
| Compound Name | 2-cyclopentyl-N-[[(2S,4S)-4-fluoro-1-pent-3-enoylpyrrolidin-2-yl]methyl]acetamide |
| PubChem CID | 91940174 |
| Molecular Formula | C17H27FN2O2 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2-cyclopentyl-N-[[(2S,4S)-4-fluoro-1-pent-3-enoylpyrrolidin-2-yl]methyl]acetamide |
| SMILES | CC=CCC(=O)N1C[C@@H](F)C[C@H]1CNC(=O)CC1CCCC1 |
| InChI | InChI=1S/C17H27FN2O2/c1-2-3-8-17(22)20-12-14(18)10-15(20)11-19-16(21)9-13-6-4-5-7-13/h2-3,13-15H,4-12H2,1H3,(H,19,21)/t14-,15-/m0/s1 |
| InChIKey | PRALXKWCMSQPHE-GJZGRUSLSA-N |
| XLogP | 2.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentyl-N-[[(2S,4S)-4-fluoro-1-pent-3-enoylpyrrolidin-2-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-N-[[(2S,4S)-4-fluoro-1-pent-3-enoylpyrrolidin-2-yl]methyl]acetamide?
The IUPAC name of 2-cyclopentyl-N-[[(2S,4S)-4-fluoro-1-pent-3-enoylpyrrolidin-2-yl]methyl]acetamide (CID 91940174) is 2-cyclopentyl-N-[[(2S,4S)-4-fluoro-1-pent-3-enoylpyrrolidin-2-yl]methyl]acetamide.
What is the SMILES notation for 2-cyclopentyl-N-[[(2S,4S)-4-fluoro-1-pent-3-enoylpyrrolidin-2-yl]methyl]acetamide?
The canonical SMILES for 2-cyclopentyl-N-[[(2S,4S)-4-fluoro-1-pent-3-enoylpyrrolidin-2-yl]methyl]acetamide is CC=CCC(=O)N1C[C@@H](F)C[C@H]1CNC(=O)CC1CCCC1.
What is the InChIKey of 2-cyclopentyl-N-[[(2S,4S)-4-fluoro-1-pent-3-enoylpyrrolidin-2-yl]methyl]acetamide?
The InChIKey is PRALXKWCMSQPHE-GJZGRUSLSA-N. The full InChI is InChI=1S/C17H27FN2O2/c1-2-3-8-17(22)20-12-14(18)10-15(20)11-19-16(21)9-13-6-4-5-7-13/h2-3,13-15H,4-12H2,1H3,(H,19,21)/t14-,15-/m0/s1.
What are the key properties of 2-cyclopentyl-N-[[(2S,4S)-4-fluoro-1-pent-3-enoylpyrrolidin-2-yl]methyl]acetamide?
2-cyclopentyl-N-[[(2S,4S)-4-fluoro-1-pent-3-enoylpyrrolidin-2-yl]methyl]acetamide has a molecular weight of 310.41 g/mol, XLogP of 2.59, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-N-[[(2S,4S)-4-fluoro-1-pent-3-enoylpyrrolidin-2-yl]methyl]acetamide is sourced from PubChem (CID 91940174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).