C24H25FN2O3S — CID 91940318
1-[(4aR,8aS)-6-(5-acetylthiophene-3-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 91940318) has the molecular formula C24H25FN2O3S and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-[(4aR,8aS)-6-(5-acetylthiophene-3-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | 1-[(4aR,8aS)-6-(5-acetylthiophene-3-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 91940318 |
| Molecular Formula | C24H25FN2O3S |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 1-[(4aR,8aS)-6-(5-acetylthiophene-3-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | CC(=O)c1cc(C(=O)N2CC[C@H]3[C@H](CCCN3C(=O)C=Cc3ccc(F)cc3)C2)cs1 |
| InChI | InChI=1S/C24H25FN2O3S/c1-16(28)22-13-19(15-31-22)24(30)26-12-10-21-18(14-26)3-2-11-27(21)23(29)9-6-17-4-7-20(25)8-5-17/h4-9,13,15,18,21H,2-3,10-12,14H2,1H3/t18-,21+/m1/s1 |
| InChIKey | SGBXTHMNQDZZBE-NQIIRXRSSA-N |
| XLogP | 4.26 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|