C25H32N2O5 — CID 91940332
(4aR,8aS)-6-[3-(furan-2-yl)prop-2-enyl]-1-[(3,4,5-trimethoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 91940332) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is (4aR,8aS)-6-[3-(furan-2-yl)prop-2-enyl]-1-[(3,4,5-trimethoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-6-[3-(furan-2-yl)prop-2-enyl]-1-[(3,4,5-trimethoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 91940332 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | (4aR,8aS)-6-[3-(furan-2-yl)prop-2-enyl]-1-[(3,4,5-trimethoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | COc1cc(CN2C(=O)CC[C@@H]3CN(CC=Cc4ccco4)CC[C@@H]32)cc(OC)c1OC |
| InChI | InChI=1S/C25H32N2O5/c1-29-22-14-18(15-23(30-2)25(22)31-3)16-27-21-10-12-26(17-19(21)8-9-24(27)28)11-4-6-20-7-5-13-32-20/h4-7,13-15,19,21H,8-12,16-17H2,1-3H3/t19-,21+/m1/s1 |
| InChIKey | PTEOULBJSBSHCX-CTNGQTDRSA-N |
| XLogP | 3.83 |
| TPSA | 64.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |