C20H24F2N2O2 — CID 91940537
2-[(3,5-difluorophenyl)methyl]-8-pent-3-enoyl-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 91940537) has the molecular formula C20H24F2N2O2 and a molecular weight of 362.42 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methyl]-8-pent-3-enoyl-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 2-[(3,5-difluorophenyl)methyl]-8-pent-3-enoyl-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 91940537 |
| Molecular Formula | C20H24F2N2O2 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methyl]-8-pent-3-enoyl-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | CC=CCC(=O)N1CCC2(CC1)CC(=O)N(Cc1cc(F)cc(F)c1)C2 |
| InChI | InChI=1S/C20H24F2N2O2/c1-2-3-4-18(25)23-7-5-20(6-8-23)12-19(26)24(14-20)13-15-9-16(21)11-17(22)10-15/h2-3,9-11H,4-8,12-14H2,1H3 |
| InChIKey | LGGPBZGWLKHIJP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|