C14H16N2O3 — CID 91941431
5-but-2-en-2-yl-3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazole (PubChem CID 91941431) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 5-but-2-en-2-yl-3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-but-2-en-2-yl-3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 91941431 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 5-but-2-en-2-yl-3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazole |
| SMILES | CC=C(C)c1nc(-c2ccc(OC)cc2OC)no1 |
| InChI | InChI=1S/C14H16N2O3/c1-5-9(2)14-15-13(16-19-14)11-7-6-10(17-3)8-12(11)18-4/h5-8H,1-4H3 |
| InChIKey | NOPPRYUODWHJAA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |