C11H13F3N2OS — CID 91942836
N-propan-2-yl-3-(1,3-thiazol-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 91942836) has the molecular formula C11H13F3N2OS and a molecular weight of 278.30 g/mol. Its IUPAC name is N-propan-2-yl-3-(1,3-thiazol-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | N-propan-2-yl-3-(1,3-thiazol-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 91942836 |
| Molecular Formula | C11H13F3N2OS |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N-propan-2-yl-3-(1,3-thiazol-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | CC(C)N(CC(F)(F)F)C(=O)C=Cc1cscn1 |
| InChI | InChI=1S/C11H13F3N2OS/c1-8(2)16(6-11(12,13)14)10(17)4-3-9-5-18-7-15-9/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | WWGBKMFMJCXOLS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|