C16H17ClN2O2 — CID 91942901
3-(furan-2-yl)-N-(1,2,3,4-tetrahydroquinolin-7-yl)prop-2-enamide;hydrochloride (PubChem CID 91942901) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-(1,2,3,4-tetrahydroquinolin-7-yl)prop-2-enamide;hydrochloride.
| Compound Name | 3-(furan-2-yl)-N-(1,2,3,4-tetrahydroquinolin-7-yl)prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 91942901 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-(furan-2-yl)-N-(1,2,3,4-tetrahydroquinolin-7-yl)prop-2-enamide;hydrochloride |
| SMILES | Cl.O=C(C=Cc1ccco1)Nc1ccc2c(c1)NCCC2 |
| InChI | InChI=1S/C16H16N2O2.ClH/c19-16(8-7-14-4-2-10-20-14)18-13-6-5-12-3-1-9-17-15(12)11-13;/h2,4-8,10-11,17H,1,3,9H2,(H,18,19);1H |
| InChIKey | HPCHYQSEAUBXIO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|