About 1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclobutane-1-carboxylic acid
1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclobutane-1-carboxylic acid (PubChem CID 91943215) has the molecular formula C13H16ClN3O3
and a molecular weight of 297.74 g/mol. Its IUPAC name is 1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclobutane-1-carboxylic acid |
| PubChem CID | 91943215 |
| Molecular Formula | C13H16ClN3O3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclobutane-1-carboxylic acid |
| SMILES | Cc1nn(C)c(Cl)c1C=CC(=O)NC1(C(=O)O)CCC1 |
| InChI | InChI=1S/C13H16ClN3O3/c1-8-9(11(14)17(2)16-8)4-5-10(18)15-13(12(19)20)6-3-7-13/h4-5H,3,6-7H2,1-2H3,(H,15,18)(H,19,20) |
| InChIKey | AXCSIEIMFNEONB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclobutane-1-carboxylic acid?
The IUPAC name of 1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclobutane-1-carboxylic acid (CID 91943215) is 1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclobutane-1-carboxylic acid is Cc1nn(C)c(Cl)c1C=CC(=O)NC1(C(=O)O)CCC1.
What is the InChIKey of 1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclobutane-1-carboxylic acid?
The InChIKey is AXCSIEIMFNEONB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClN3O3/c1-8-9(11(14)17(2)16-8)4-5-10(18)15-13(12(19)20)6-3-7-13/h4-5H,3,6-7H2,1-2H3,(H,15,18)(H,19,20).
What are the key properties of 1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclobutane-1-carboxylic acid?
1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclobutane-1-carboxylic acid has a molecular weight of 297.74 g/mol, XLogP of 1.52, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclobutane-1-carboxylic acid is sourced from PubChem (CID 91943215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).