About 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-2-methylbutanoic acid
2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-2-methylbutanoic acid (PubChem CID 91943258) has the molecular formula C15H22N2O3S
and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-2-methylbutanoic acid.
Molecular Properties
| Compound Name | 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-2-methylbutanoic acid |
| PubChem CID | 91943258 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-2-methylbutanoic acid |
| SMILES | CCC(C)(NC(=O)C=Cc1cnc(C(C)(C)C)s1)C(=O)O |
| InChI | InChI=1S/C15H22N2O3S/c1-6-15(5,13(19)20)17-11(18)8-7-10-9-16-12(21-10)14(2,3)4/h7-9H,6H2,1-5H3,(H,17,18)(H,19,20) |
| InChIKey | HIAQYIPJTXEIJJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-2-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-2-methylbutanoic acid?
The IUPAC name of 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-2-methylbutanoic acid (CID 91943258) is 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-2-methylbutanoic acid.
What is the SMILES notation for 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-2-methylbutanoic acid?
The canonical SMILES for 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-2-methylbutanoic acid is CCC(C)(NC(=O)C=Cc1cnc(C(C)(C)C)s1)C(=O)O.
What is the InChIKey of 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-2-methylbutanoic acid?
The InChIKey is HIAQYIPJTXEIJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3S/c1-6-15(5,13(19)20)17-11(18)8-7-10-9-16-12(21-10)14(2,3)4/h7-9H,6H2,1-5H3,(H,17,18)(H,19,20).
What are the key properties of 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-2-methylbutanoic acid?
2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-2-methylbutanoic acid has a molecular weight of 310.42 g/mol, XLogP of 2.82, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-2-methylbutanoic acid is sourced from PubChem (CID 91943258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).