About 6-(naphthalen-1-ylmethylidene)-7,8-dihydro-1H-quinoline-2,5-dione
6-(naphthalen-1-ylmethylidene)-7,8-dihydro-1H-quinoline-2,5-dione (PubChem CID 91943336) has the molecular formula C20H15NO2
and a molecular weight of 301.35 g/mol. Its IUPAC name is 6-(naphthalen-1-ylmethylidene)-7,8-dihydro-1H-quinoline-2,5-dione.
Molecular Properties
| Compound Name | 6-(naphthalen-1-ylmethylidene)-7,8-dihydro-1H-quinoline-2,5-dione |
| PubChem CID | 91943336 |
| Molecular Formula | C20H15NO2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 6-(naphthalen-1-ylmethylidene)-7,8-dihydro-1H-quinoline-2,5-dione |
| SMILES | O=C1C(=Cc2cccc3ccccc23)CCc2[nH]c(=O)ccc21 |
| InChI | InChI=1S/C20H15NO2/c22-19-11-9-17-18(21-19)10-8-15(20(17)23)12-14-6-3-5-13-4-1-2-7-16(13)14/h1-7,9,11-12H,8,10H2,(H,21,22) |
| InChIKey | PRUBSPGPWISKEN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(naphthalen-1-ylmethylidene)-7,8-dihydro-1H-quinoline-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(naphthalen-1-ylmethylidene)-7,8-dihydro-1H-quinoline-2,5-dione?
The IUPAC name of 6-(naphthalen-1-ylmethylidene)-7,8-dihydro-1H-quinoline-2,5-dione (CID 91943336) is 6-(naphthalen-1-ylmethylidene)-7,8-dihydro-1H-quinoline-2,5-dione.
What is the SMILES notation for 6-(naphthalen-1-ylmethylidene)-7,8-dihydro-1H-quinoline-2,5-dione?
The canonical SMILES for 6-(naphthalen-1-ylmethylidene)-7,8-dihydro-1H-quinoline-2,5-dione is O=C1C(=Cc2cccc3ccccc23)CCc2[nH]c(=O)ccc21.
What is the InChIKey of 6-(naphthalen-1-ylmethylidene)-7,8-dihydro-1H-quinoline-2,5-dione?
The InChIKey is PRUBSPGPWISKEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15NO2/c22-19-11-9-17-18(21-19)10-8-15(20(17)23)12-14-6-3-5-13-4-1-2-7-16(13)14/h1-7,9,11-12H,8,10H2,(H,21,22).
What are the key properties of 6-(naphthalen-1-ylmethylidene)-7,8-dihydro-1H-quinoline-2,5-dione?
6-(naphthalen-1-ylmethylidene)-7,8-dihydro-1H-quinoline-2,5-dione has a molecular weight of 301.35 g/mol, XLogP of 3.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(naphthalen-1-ylmethylidene)-7,8-dihydro-1H-quinoline-2,5-dione is sourced from PubChem (CID 91943336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).