About [(2S)-2-hydrazinyl-5,5-dimethyl-2-(trifluoromethyl)oxan-4-ylidene]hydrazine
[(2S)-2-hydrazinyl-5,5-dimethyl-2-(trifluoromethyl)oxan-4-ylidene]hydrazine (PubChem CID 919435) has the molecular formula C8H15F3N4O
and a molecular weight of 240.23 g/mol. Its IUPAC name is [(2S)-2-hydrazinyl-5,5-dimethyl-2-(trifluoromethyl)oxan-4-ylidene]hydrazine.
Molecular Properties
| Compound Name | [(2S)-2-hydrazinyl-5,5-dimethyl-2-(trifluoromethyl)oxan-4-ylidene]hydrazine |
| PubChem CID | 919435 |
| Molecular Formula | C8H15F3N4O |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | [(2S)-2-hydrazinyl-5,5-dimethyl-2-(trifluoromethyl)oxan-4-ylidene]hydrazine |
| SMILES | CC1(C)CO[C@](NN)(C(F)(F)F)CC1=NN |
| InChI | InChI=1S/C8H15F3N4O/c1-6(2)4-16-7(15-13,8(9,10)11)3-5(6)14-12/h15H,3-4,12-13H2,1-2H3/t7-/m0/s1 |
| InChIKey | TXEJUMYLNCHJQX-ZETCQYMHSA-N |
| XLogP | 0.47 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-hydrazinyl-5,5-dimethyl-2-(trifluoromethyl)oxan-4-ylidene]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-hydrazinyl-5,5-dimethyl-2-(trifluoromethyl)oxan-4-ylidene]hydrazine?
The IUPAC name of [(2S)-2-hydrazinyl-5,5-dimethyl-2-(trifluoromethyl)oxan-4-ylidene]hydrazine (CID 919435) is [(2S)-2-hydrazinyl-5,5-dimethyl-2-(trifluoromethyl)oxan-4-ylidene]hydrazine.
What is the SMILES notation for [(2S)-2-hydrazinyl-5,5-dimethyl-2-(trifluoromethyl)oxan-4-ylidene]hydrazine?
The canonical SMILES for [(2S)-2-hydrazinyl-5,5-dimethyl-2-(trifluoromethyl)oxan-4-ylidene]hydrazine is CC1(C)CO[C@](NN)(C(F)(F)F)CC1=NN.
What is the InChIKey of [(2S)-2-hydrazinyl-5,5-dimethyl-2-(trifluoromethyl)oxan-4-ylidene]hydrazine?
The InChIKey is TXEJUMYLNCHJQX-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H15F3N4O/c1-6(2)4-16-7(15-13,8(9,10)11)3-5(6)14-12/h15H,3-4,12-13H2,1-2H3/t7-/m0/s1.
What are the key properties of [(2S)-2-hydrazinyl-5,5-dimethyl-2-(trifluoromethyl)oxan-4-ylidene]hydrazine?
[(2S)-2-hydrazinyl-5,5-dimethyl-2-(trifluoromethyl)oxan-4-ylidene]hydrazine has a molecular weight of 240.23 g/mol, XLogP of 0.47, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-hydrazinyl-5,5-dimethyl-2-(trifluoromethyl)oxan-4-ylidene]hydrazine is sourced from PubChem (CID 919435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).