C15H22N4O2 — CID 91944028
N,N-diethyl-4-(3-pyrimidin-4-ylprop-2-enoylamino)butanamide (PubChem CID 91944028) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is N,N-diethyl-4-(3-pyrimidin-4-ylprop-2-enoylamino)butanamide.
| Compound Name | N,N-diethyl-4-(3-pyrimidin-4-ylprop-2-enoylamino)butanamide |
|---|---|
| PubChem CID | 91944028 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N,N-diethyl-4-(3-pyrimidin-4-ylprop-2-enoylamino)butanamide |
| SMILES | CCN(CC)C(=O)CCCNC(=O)C=Cc1ccncn1 |
| InChI | InChI=1S/C15H22N4O2/c1-3-19(4-2)15(21)6-5-10-17-14(20)8-7-13-9-11-16-12-18-13/h7-9,11-12H,3-6,10H2,1-2H3,(H,17,20) |
| InChIKey | BRMQOHWUGRQOAP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|