C12H14N4O2S — CID 91944258
3-(4-methyl-1,3-oxazol-2-yl)-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 91944258) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 3-(4-methyl-1,3-oxazol-2-yl)-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | 3-(4-methyl-1,3-oxazol-2-yl)-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 91944258 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3-(4-methyl-1,3-oxazol-2-yl)-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | Cc1coc(C=CC(=O)Nc2nnc(C(C)C)s2)n1 |
| InChI | InChI=1S/C12H14N4O2S/c1-7(2)11-15-16-12(19-11)14-9(17)4-5-10-13-8(3)6-18-10/h4-7H,1-3H3,(H,14,16,17) |
| InChIKey | XOXXTWDUPNCSRM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|