C12H11N7O2 — CID 91945235
4-amino-N'-[[2-(cyanomethoxy)phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 91945235) has the molecular formula C12H11N7O2 and a molecular weight of 285.27 g/mol. Its IUPAC name is 4-amino-N'-[[2-(cyanomethoxy)phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-[[2-(cyanomethoxy)phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 91945235 |
| Molecular Formula | C12H11N7O2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 4-amino-N'-[[2-(cyanomethoxy)phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N#CCOc1ccccc1C=N/N=C(\N)c1nonc1N |
| InChI | InChI=1S/C12H11N7O2/c13-5-6-20-9-4-2-1-3-8(9)7-16-17-11(14)10-12(15)19-21-18-10/h1-4,7H,6H2,(H2,14,17)(H2,15,19) |
| InChIKey | DKGQVOVJYVWKSW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 148.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|