About 1-ethyl-3,5-dimethyl-N-phenylpyrazolo[4,5-d]pyrimidin-7-amine
1-ethyl-3,5-dimethyl-N-phenylpyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 91946197) has the molecular formula C15H17N5
and a molecular weight of 267.34 g/mol. Its IUPAC name is 1-ethyl-3,5-dimethyl-N-phenylpyrazolo[4,5-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 1-ethyl-3,5-dimethyl-N-phenylpyrazolo[4,5-d]pyrimidin-7-amine |
| PubChem CID | 91946197 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 1-ethyl-3,5-dimethyl-N-phenylpyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCn1nc(C)c2nc(C)nc(Nc3ccccc3)c21 |
| InChI | InChI=1S/C15H17N5/c1-4-20-14-13(10(2)19-20)16-11(3)17-15(14)18-12-8-6-5-7-9-12/h5-9H,4H2,1-3H3,(H,16,17,18) |
| InChIKey | KFAIMGFMHCGYIX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-3,5-dimethyl-N-phenylpyrazolo[4,5-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,5-dimethyl-N-phenylpyrazolo[4,5-d]pyrimidin-7-amine?
The IUPAC name of 1-ethyl-3,5-dimethyl-N-phenylpyrazolo[4,5-d]pyrimidin-7-amine (CID 91946197) is 1-ethyl-3,5-dimethyl-N-phenylpyrazolo[4,5-d]pyrimidin-7-amine.
What is the SMILES notation for 1-ethyl-3,5-dimethyl-N-phenylpyrazolo[4,5-d]pyrimidin-7-amine?
The canonical SMILES for 1-ethyl-3,5-dimethyl-N-phenylpyrazolo[4,5-d]pyrimidin-7-amine is CCn1nc(C)c2nc(C)nc(Nc3ccccc3)c21.
What is the InChIKey of 1-ethyl-3,5-dimethyl-N-phenylpyrazolo[4,5-d]pyrimidin-7-amine?
The InChIKey is KFAIMGFMHCGYIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5/c1-4-20-14-13(10(2)19-20)16-11(3)17-15(14)18-12-8-6-5-7-9-12/h5-9H,4H2,1-3H3,(H,16,17,18).
What are the key properties of 1-ethyl-3,5-dimethyl-N-phenylpyrazolo[4,5-d]pyrimidin-7-amine?
1-ethyl-3,5-dimethyl-N-phenylpyrazolo[4,5-d]pyrimidin-7-amine has a molecular weight of 267.34 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,5-dimethyl-N-phenylpyrazolo[4,5-d]pyrimidin-7-amine is sourced from PubChem (CID 91946197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).