C25H27N3O2 — CID 91947244
(3-methyl-1-benzofuran-2-yl)-[3-(1-propylbenzimidazol-2-yl)piperidin-1-yl]methanone (PubChem CID 91947244) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is (3-methyl-1-benzofuran-2-yl)-[3-(1-propylbenzimidazol-2-yl)piperidin-1-yl]methanone.
| Compound Name | (3-methyl-1-benzofuran-2-yl)-[3-(1-propylbenzimidazol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 91947244 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | (3-methyl-1-benzofuran-2-yl)-[3-(1-propylbenzimidazol-2-yl)piperidin-1-yl]methanone |
| SMILES | CCCn1c(C2CCCN(C(=O)c3oc4ccccc4c3C)C2)nc2ccccc21 |
| InChI | InChI=1S/C25H27N3O2/c1-3-14-28-21-12-6-5-11-20(21)26-24(28)18-9-8-15-27(16-18)25(29)23-17(2)19-10-4-7-13-22(19)30-23/h4-7,10-13,18H,3,8-9,14-16H2,1-2H3 |
| InChIKey | OJVXLGFZWUJRNX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |