C18H20N6O3 — CID 91948346
1,3-dimethyl-8-[1-(pyridine-3-carbonyl)piperidin-4-yl]-7H-purine-2,6-dione (PubChem CID 91948346) has the molecular formula C18H20N6O3 and a molecular weight of 368.40 g/mol. Its IUPAC name is 1,3-dimethyl-8-[1-(pyridine-3-carbonyl)piperidin-4-yl]-7H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-[1-(pyridine-3-carbonyl)piperidin-4-yl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 91948346 |
| Molecular Formula | C18H20N6O3 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1,3-dimethyl-8-[1-(pyridine-3-carbonyl)piperidin-4-yl]-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(C3CCN(C(=O)c4cccnc4)CC3)nc2n(C)c1=O |
| InChI | InChI=1S/C18H20N6O3/c1-22-15-13(17(26)23(2)18(22)27)20-14(21-15)11-5-8-24(9-6-11)16(25)12-4-3-7-19-10-12/h3-4,7,10-11H,5-6,8-9H2,1-2H3,(H,20,21) |
| InChIKey | DHUWWQKHUVJUIH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 105.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |