C17H30N4O4S — CID 91948709
N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(4-methylsulfonylpiperazin-1-yl)-5-oxopentanamide (PubChem CID 91948709) has the molecular formula C17H30N4O4S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(4-methylsulfonylpiperazin-1-yl)-5-oxopentanamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(4-methylsulfonylpiperazin-1-yl)-5-oxopentanamide |
|---|---|
| PubChem CID | 91948709 |
| Molecular Formula | C17H30N4O4S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(4-methylsulfonylpiperazin-1-yl)-5-oxopentanamide |
| SMILES | CS(=O)(=O)N1CCN(C(=O)CCCC(=O)NC2CN3CCC2CC3)CC1 |
| InChI | InChI=1S/C17H30N4O4S/c1-26(24,25)21-11-9-20(10-12-21)17(23)4-2-3-16(22)18-15-13-19-7-5-14(15)6-8-19/h14-15H,2-13H2,1H3,(H,18,22) |
| InChIKey | MXOQXGKMKVPSIA-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |