C21H21N3O3 — CID 91950188
6-methyl-5-(6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-prop-2-enylfuro[2,3-d]pyrimidin-4-one (PubChem CID 91950188) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 6-methyl-5-(6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-prop-2-enylfuro[2,3-d]pyrimidin-4-one.
| Compound Name | 6-methyl-5-(6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-prop-2-enylfuro[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 91950188 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 6-methyl-5-(6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-3-prop-2-enylfuro[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1cnc2oc(C)c(C(=O)N3CCCc4cc(C)ccc43)c2c1=O |
| InChI | InChI=1S/C21H21N3O3/c1-4-9-23-12-22-19-18(20(23)25)17(14(3)27-19)21(26)24-10-5-6-15-11-13(2)7-8-16(15)24/h4,7-8,11-12H,1,5-6,9-10H2,2-3H3 |
| InChIKey | XVIHXNIGHYMRRS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|