C23H25N5O4 — CID 91950234
3-(3-methoxypropyl)-6-methyl-4-oxo-N-[2-(1-phenylethyl)pyrazol-3-yl]furo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 91950234) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-6-methyl-4-oxo-N-[2-(1-phenylethyl)pyrazol-3-yl]furo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 3-(3-methoxypropyl)-6-methyl-4-oxo-N-[2-(1-phenylethyl)pyrazol-3-yl]furo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 91950234 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 3-(3-methoxypropyl)-6-methyl-4-oxo-N-[2-(1-phenylethyl)pyrazol-3-yl]furo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | COCCCn1cnc2oc(C)c(C(=O)Nc3ccnn3C(C)c3ccccc3)c2c1=O |
| InChI | InChI=1S/C23H25N5O4/c1-15(17-8-5-4-6-9-17)28-18(10-11-25-28)26-21(29)19-16(2)32-22-20(19)23(30)27(14-24-22)12-7-13-31-3/h4-6,8-11,14-15H,7,12-13H2,1-3H3,(H,26,29) |
| InChIKey | LDZOZXRJKMEWLD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|