C17H14F2N4OS — CID 9195035
N-(3,4-difluorophenyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)acetamide (PubChem CID 9195035) has the molecular formula C17H14F2N4OS and a molecular weight of 360.39 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)acetamide |
|---|---|
| PubChem CID | 9195035 |
| Molecular Formula | C17H14F2N4OS |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)acetamide |
| SMILES | O=C(CNc1ncnc2sc3c(c12)CCC3)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H14F2N4OS/c18-11-5-4-9(6-12(11)19)23-14(24)7-20-16-15-10-2-1-3-13(10)25-17(15)22-8-21-16/h4-6,8H,1-3,7H2,(H,23,24)(H,20,21,22) |
| InChIKey | DIPBNDKSIFSQOK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |