About 3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-6-oxopyrimidin-1-yl]-N-(oxolan-2-ylmethyl)propanamide
3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-6-oxopyrimidin-1-yl]-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 91950880) has the molecular formula C15H19N5O4
and a molecular weight of 333.35 g/mol. Its IUPAC name is 3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-6-oxopyrimidin-1-yl]-N-(oxolan-2-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-6-oxopyrimidin-1-yl]-N-(oxolan-2-ylmethyl)propanamide |
| PubChem CID | 91950880 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-6-oxopyrimidin-1-yl]-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | Cc1noc(-c2cncn(CCC(=O)NCC3CCCO3)c2=O)n1 |
| InChI | InChI=1S/C15H19N5O4/c1-10-18-14(24-19-10)12-8-16-9-20(15(12)22)5-4-13(21)17-7-11-3-2-6-23-11/h8-9,11H,2-7H2,1H3,(H,17,21) |
| InChIKey | OHGNPDTXQQONEM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-6-oxopyrimidin-1-yl]-N-(oxolan-2-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-6-oxopyrimidin-1-yl]-N-(oxolan-2-ylmethyl)propanamide?
The IUPAC name of 3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-6-oxopyrimidin-1-yl]-N-(oxolan-2-ylmethyl)propanamide (CID 91950880) is 3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-6-oxopyrimidin-1-yl]-N-(oxolan-2-ylmethyl)propanamide.
What is the SMILES notation for 3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-6-oxopyrimidin-1-yl]-N-(oxolan-2-ylmethyl)propanamide?
The canonical SMILES for 3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-6-oxopyrimidin-1-yl]-N-(oxolan-2-ylmethyl)propanamide is Cc1noc(-c2cncn(CCC(=O)NCC3CCCO3)c2=O)n1.
What is the InChIKey of 3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-6-oxopyrimidin-1-yl]-N-(oxolan-2-ylmethyl)propanamide?
The InChIKey is OHGNPDTXQQONEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O4/c1-10-18-14(24-19-10)12-8-16-9-20(15(12)22)5-4-13(21)17-7-11-3-2-6-23-11/h8-9,11H,2-7H2,1H3,(H,17,21).
What are the key properties of 3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-6-oxopyrimidin-1-yl]-N-(oxolan-2-ylmethyl)propanamide?
3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-6-oxopyrimidin-1-yl]-N-(oxolan-2-ylmethyl)propanamide has a molecular weight of 333.35 g/mol, XLogP of 0.29, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-6-oxopyrimidin-1-yl]-N-(oxolan-2-ylmethyl)propanamide is sourced from PubChem (CID 91950880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).