About 5-(3-methyl-1,2,4-oxadiazol-5-yl)-3-(3-oxo-3-piperidin-1-ylpropyl)pyrimidin-4-one
5-(3-methyl-1,2,4-oxadiazol-5-yl)-3-(3-oxo-3-piperidin-1-ylpropyl)pyrimidin-4-one (PubChem CID 91950901) has the molecular formula C15H19N5O3
and a molecular weight of 317.35 g/mol. Its IUPAC name is 5-(3-methyl-1,2,4-oxadiazol-5-yl)-3-(3-oxo-3-piperidin-1-ylpropyl)pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-(3-methyl-1,2,4-oxadiazol-5-yl)-3-(3-oxo-3-piperidin-1-ylpropyl)pyrimidin-4-one |
| PubChem CID | 91950901 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 5-(3-methyl-1,2,4-oxadiazol-5-yl)-3-(3-oxo-3-piperidin-1-ylpropyl)pyrimidin-4-one |
| SMILES | Cc1noc(-c2cncn(CCC(=O)N3CCCCC3)c2=O)n1 |
| InChI | InChI=1S/C15H19N5O3/c1-11-17-14(23-18-11)12-9-16-10-20(15(12)22)8-5-13(21)19-6-3-2-4-7-19/h9-10H,2-8H2,1H3 |
| InChIKey | UPBADTWFTWZBMG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(3-methyl-1,2,4-oxadiazol-5-yl)-3-(3-oxo-3-piperidin-1-ylpropyl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methyl-1,2,4-oxadiazol-5-yl)-3-(3-oxo-3-piperidin-1-ylpropyl)pyrimidin-4-one?
The IUPAC name of 5-(3-methyl-1,2,4-oxadiazol-5-yl)-3-(3-oxo-3-piperidin-1-ylpropyl)pyrimidin-4-one (CID 91950901) is 5-(3-methyl-1,2,4-oxadiazol-5-yl)-3-(3-oxo-3-piperidin-1-ylpropyl)pyrimidin-4-one.
What is the SMILES notation for 5-(3-methyl-1,2,4-oxadiazol-5-yl)-3-(3-oxo-3-piperidin-1-ylpropyl)pyrimidin-4-one?
The canonical SMILES for 5-(3-methyl-1,2,4-oxadiazol-5-yl)-3-(3-oxo-3-piperidin-1-ylpropyl)pyrimidin-4-one is Cc1noc(-c2cncn(CCC(=O)N3CCCCC3)c2=O)n1.
What is the InChIKey of 5-(3-methyl-1,2,4-oxadiazol-5-yl)-3-(3-oxo-3-piperidin-1-ylpropyl)pyrimidin-4-one?
The InChIKey is UPBADTWFTWZBMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O3/c1-11-17-14(23-18-11)12-9-16-10-20(15(12)22)8-5-13(21)19-6-3-2-4-7-19/h9-10H,2-8H2,1H3.
What are the key properties of 5-(3-methyl-1,2,4-oxadiazol-5-yl)-3-(3-oxo-3-piperidin-1-ylpropyl)pyrimidin-4-one?
5-(3-methyl-1,2,4-oxadiazol-5-yl)-3-(3-oxo-3-piperidin-1-ylpropyl)pyrimidin-4-one has a molecular weight of 317.35 g/mol, XLogP of 1.00, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methyl-1,2,4-oxadiazol-5-yl)-3-(3-oxo-3-piperidin-1-ylpropyl)pyrimidin-4-one is sourced from PubChem (CID 91950901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).