About N-[2-(4-butylsulfonylpiperazin-1-yl)ethyl]-1,6-naphthyridin-8-amine
N-[2-(4-butylsulfonylpiperazin-1-yl)ethyl]-1,6-naphthyridin-8-amine (PubChem CID 91953388) has the molecular formula C18H27N5O2S
and a molecular weight of 377.51 g/mol. Its IUPAC name is N-[2-(4-butylsulfonylpiperazin-1-yl)ethyl]-1,6-naphthyridin-8-amine.
Molecular Properties
| Compound Name | N-[2-(4-butylsulfonylpiperazin-1-yl)ethyl]-1,6-naphthyridin-8-amine |
| PubChem CID | 91953388 |
| Molecular Formula | C18H27N5O2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[2-(4-butylsulfonylpiperazin-1-yl)ethyl]-1,6-naphthyridin-8-amine |
| SMILES | CCCCS(=O)(=O)N1CCN(CCNc2cncc3cccnc23)CC1 |
| InChI | InChI=1S/C18H27N5O2S/c1-2-3-13-26(24,25)23-11-9-22(10-12-23)8-7-20-17-15-19-14-16-5-4-6-21-18(16)17/h4-6,14-15,20H,2-3,7-13H2,1H3 |
| InChIKey | FZTJPYCZSOQILM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(4-butylsulfonylpiperazin-1-yl)ethyl]-1,6-naphthyridin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-butylsulfonylpiperazin-1-yl)ethyl]-1,6-naphthyridin-8-amine?
The IUPAC name of N-[2-(4-butylsulfonylpiperazin-1-yl)ethyl]-1,6-naphthyridin-8-amine (CID 91953388) is N-[2-(4-butylsulfonylpiperazin-1-yl)ethyl]-1,6-naphthyridin-8-amine.
What is the SMILES notation for N-[2-(4-butylsulfonylpiperazin-1-yl)ethyl]-1,6-naphthyridin-8-amine?
The canonical SMILES for N-[2-(4-butylsulfonylpiperazin-1-yl)ethyl]-1,6-naphthyridin-8-amine is CCCCS(=O)(=O)N1CCN(CCNc2cncc3cccnc23)CC1.
What is the InChIKey of N-[2-(4-butylsulfonylpiperazin-1-yl)ethyl]-1,6-naphthyridin-8-amine?
The InChIKey is FZTJPYCZSOQILM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N5O2S/c1-2-3-13-26(24,25)23-11-9-22(10-12-23)8-7-20-17-15-19-14-16-5-4-6-21-18(16)17/h4-6,14-15,20H,2-3,7-13H2,1H3.
What are the key properties of N-[2-(4-butylsulfonylpiperazin-1-yl)ethyl]-1,6-naphthyridin-8-amine?
N-[2-(4-butylsulfonylpiperazin-1-yl)ethyl]-1,6-naphthyridin-8-amine has a molecular weight of 377.51 g/mol, XLogP of 1.79, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-butylsulfonylpiperazin-1-yl)ethyl]-1,6-naphthyridin-8-amine is sourced from PubChem (CID 91953388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).