C19H20N4O — CID 91953450
8-[4-(4-methoxyphenyl)piperazin-1-yl]-1,6-naphthyridine (PubChem CID 91953450) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 8-[4-(4-methoxyphenyl)piperazin-1-yl]-1,6-naphthyridine.
| Compound Name | 8-[4-(4-methoxyphenyl)piperazin-1-yl]-1,6-naphthyridine |
|---|---|
| PubChem CID | 91953450 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 8-[4-(4-methoxyphenyl)piperazin-1-yl]-1,6-naphthyridine |
| SMILES | COc1ccc(N2CCN(c3cncc4cccnc34)CC2)cc1 |
| InChI | InChI=1S/C19H20N4O/c1-24-17-6-4-16(5-7-17)22-9-11-23(12-10-22)18-14-20-13-15-3-2-8-21-19(15)18/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | YBWSOOAPKBTRDK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|