C10H15N3O3S2 — CID 91956017
N,N,4-trimethyl-2-(prop-2-enylsulfonylamino)-1,3-thiazole-5-carboxamide (PubChem CID 91956017) has the molecular formula C10H15N3O3S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N,N,4-trimethyl-2-(prop-2-enylsulfonylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | N,N,4-trimethyl-2-(prop-2-enylsulfonylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 91956017 |
| Molecular Formula | C10H15N3O3S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N,N,4-trimethyl-2-(prop-2-enylsulfonylamino)-1,3-thiazole-5-carboxamide |
| SMILES | C=CCS(=O)(=O)Nc1nc(C)c(C(=O)N(C)C)s1 |
| InChI | InChI=1S/C10H15N3O3S2/c1-5-6-18(15,16)12-10-11-7(2)8(17-10)9(14)13(3)4/h5H,1,6H2,2-4H3,(H,11,12) |
| InChIKey | ZMOWTQGAZMTQRE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|