C18H21N3O3S — CID 91956253
N-(3-indazol-1-ylpropyl)-2-phenoxyethanesulfonamide (PubChem CID 91956253) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-(3-indazol-1-ylpropyl)-2-phenoxyethanesulfonamide.
| Compound Name | N-(3-indazol-1-ylpropyl)-2-phenoxyethanesulfonamide |
|---|---|
| PubChem CID | 91956253 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-(3-indazol-1-ylpropyl)-2-phenoxyethanesulfonamide |
| SMILES | O=S(=O)(CCOc1ccccc1)NCCCn1ncc2ccccc21 |
| InChI | InChI=1S/C18H21N3O3S/c22-25(23,14-13-24-17-8-2-1-3-9-17)20-11-6-12-21-18-10-5-4-7-16(18)15-19-21/h1-5,7-10,15,20H,6,11-14H2 |
| InChIKey | NKESNKKGGGNHCC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|