C17H22N2O3S2 — CID 91956313
N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-phenylmethoxyethanesulfonamide (PubChem CID 91956313) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-phenylmethoxyethanesulfonamide.
| Compound Name | N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-phenylmethoxyethanesulfonamide |
|---|---|
| PubChem CID | 91956313 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-phenylmethoxyethanesulfonamide |
| SMILES | CC1CCc2nc(NS(=O)(=O)CCOCc3ccccc3)sc2C1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-13-7-8-15-16(11-13)23-17(18-15)19-24(20,21)10-9-22-12-14-5-3-2-4-6-14/h2-6,13H,7-12H2,1H3,(H,18,19) |
| InChIKey | YYQOODGGDASRSL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|