C21H17F3N4O3 — CID 91957106
2,3-dihydro-1,4-benzodioxin-6-yl-[8-phenyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 91957106) has the molecular formula C21H17F3N4O3 and a molecular weight of 430.39 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl-[8-phenyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl-[8-phenyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 91957106 |
| Molecular Formula | C21H17F3N4O3 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl-[8-phenyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)OCCO2)N1CCn2c(nnc2C(F)(F)F)C1c1ccccc1 |
| InChI | InChI=1S/C21H17F3N4O3/c22-21(23,24)20-26-25-18-17(13-4-2-1-3-5-13)27(8-9-28(18)20)19(29)14-6-7-15-16(12-14)31-11-10-30-15/h1-7,12,17H,8-11H2 |
| InChIKey | LSDNKGJYIZVCRA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |