C18H30N6O — CID 91961243
N',N'-diethyl-N-(6-methyl-2-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)propane-1,3-diamine (PubChem CID 91961243) has the molecular formula C18H30N6O and a molecular weight of 346.48 g/mol. Its IUPAC name is N',N'-diethyl-N-(6-methyl-2-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-(6-methyl-2-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 91961243 |
| Molecular Formula | C18H30N6O |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | N',N'-diethyl-N-(6-methyl-2-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(N2CCOCC2)nc2[nH]c(C)cc12 |
| InChI | InChI=1S/C18H30N6O/c1-4-23(5-2)8-6-7-19-16-15-13-14(3)20-17(15)22-18(21-16)24-9-11-25-12-10-24/h13H,4-12H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | WBEMHMLBZSDWKV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|