C29H23NO5 — CID 91962315
12-(3,4,5-trimethoxyphenyl)-9-oxa-13-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,15,17,19,21-nonaen-10-one (PubChem CID 91962315) has the molecular formula C29H23NO5 and a molecular weight of 465.51 g/mol. Its IUPAC name is 12-(3,4,5-trimethoxyphenyl)-9-oxa-13-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,15,17,19,21-nonaen-10-one.
| Compound Name | 12-(3,4,5-trimethoxyphenyl)-9-oxa-13-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,15,17,19,21-nonaen-10-one |
|---|---|
| PubChem CID | 91962315 |
| Molecular Formula | C29H23NO5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 12-(3,4,5-trimethoxyphenyl)-9-oxa-13-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,15,17,19,21-nonaen-10-one |
| SMILES | COc1cc(C2Nc3ccc4ccccc4c3-c3c2c(=O)oc2ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C29H23NO5/c1-32-22-14-17(15-23(33-2)28(22)34-3)27-26-25(19-10-6-7-11-21(19)35-29(26)31)24-18-9-5-4-8-16(18)12-13-20(24)30-27/h4-15,27,30H,1-3H3 |
| InChIKey | LWVCZVINEQSUJA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|