C16H17N3O4 — CID 91962402
1-[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl]-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 91962402) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl]-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl]-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 91962402 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl]-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | Cn1c(=O)n(C)c(=O)n(CC(=O)c2ccc3c(c2)CCC3)c1=O |
| InChI | InChI=1S/C16H17N3O4/c1-17-14(21)18(2)16(23)19(15(17)22)9-13(20)12-7-6-10-4-3-5-11(10)8-12/h6-8H,3-5,9H2,1-2H3 |
| InChIKey | DFIMZEFHXHVAKX-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |