C23H26N4OS — CID 9196243
4-[[12-(3,4-dihydro-1H-isoquinolin-2-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholine (PubChem CID 9196243) has the molecular formula C23H26N4OS and a molecular weight of 406.56 g/mol. Its IUPAC name is 4-[[12-(3,4-dihydro-1H-isoquinolin-2-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholine.
| Compound Name | 4-[[12-(3,4-dihydro-1H-isoquinolin-2-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholine |
|---|---|
| PubChem CID | 9196243 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 4-[[12-(3,4-dihydro-1H-isoquinolin-2-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholine |
| SMILES | c1ccc2c(c1)CCN(c1nc(CN3CCOCC3)nc3sc4c(c13)CCC4)C2 |
| InChI | InChI=1S/C23H26N4OS/c1-2-5-17-14-27(9-8-16(17)4-1)22-21-18-6-3-7-19(18)29-23(21)25-20(24-22)15-26-10-12-28-13-11-26/h1-2,4-5H,3,6-15H2 |
| InChIKey | CVHZEJVKWRELGH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |