C25H18N4OS — CID 91962931
3-(1-benzofuran-2-yl)-6-(2,2-diphenylethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 91962931) has the molecular formula C25H18N4OS and a molecular weight of 422.51 g/mol. Its IUPAC name is 3-(1-benzofuran-2-yl)-6-(2,2-diphenylethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(1-benzofuran-2-yl)-6-(2,2-diphenylethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 91962931 |
| Molecular Formula | C25H18N4OS |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 3-(1-benzofuran-2-yl)-6-(2,2-diphenylethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | c1ccc(C(Cc2nn3c(-c4cc5ccccc5o4)nnc3s2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H18N4OS/c1-3-9-17(10-4-1)20(18-11-5-2-6-12-18)16-23-28-29-24(26-27-25(29)31-23)22-15-19-13-7-8-14-21(19)30-22/h1-15,20H,16H2 |
| InChIKey | PMNACXVZBFXJOZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |