C17H18N4O2 — CID 91963677
2-[[4-(2-methoxyethylamino)quinazolin-2-yl]amino]phenol (PubChem CID 91963677) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 2-[[4-(2-methoxyethylamino)quinazolin-2-yl]amino]phenol.
| Compound Name | 2-[[4-(2-methoxyethylamino)quinazolin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 91963677 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[[4-(2-methoxyethylamino)quinazolin-2-yl]amino]phenol |
| SMILES | COCCNc1nc(Nc2ccccc2O)nc2ccccc12 |
| InChI | InChI=1S/C17H18N4O2/c1-23-11-10-18-16-12-6-2-3-7-13(12)19-17(21-16)20-14-8-4-5-9-15(14)22/h2-9,22H,10-11H2,1H3,(H2,18,19,20,21) |
| InChIKey | BRSZTFUVDLRGGH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|