C16H15N5O2 — CID 91964013
2-[[2-(pyridin-4-ylamino)quinazolin-4-yl]amino]propanoic acid (PubChem CID 91964013) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-[[2-(pyridin-4-ylamino)quinazolin-4-yl]amino]propanoic acid.
| Compound Name | 2-[[2-(pyridin-4-ylamino)quinazolin-4-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 91964013 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-[[2-(pyridin-4-ylamino)quinazolin-4-yl]amino]propanoic acid |
| SMILES | CC(Nc1nc(Nc2ccncc2)nc2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H15N5O2/c1-10(15(22)23)18-14-12-4-2-3-5-13(12)20-16(21-14)19-11-6-8-17-9-7-11/h2-10H,1H3,(H,22,23)(H2,17,18,19,20,21) |
| InChIKey | QAEVBLKECQCKQL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |