C21H19N3O2S — CID 91964417
N-[(2,4-dimethoxyphenyl)methyl]-2-thiophen-2-ylquinazolin-4-amine (PubChem CID 91964417) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-2-thiophen-2-ylquinazolin-4-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-2-thiophen-2-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 91964417 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-2-thiophen-2-ylquinazolin-4-amine |
| SMILES | COc1ccc(CNc2nc(-c3cccs3)nc3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C21H19N3O2S/c1-25-15-10-9-14(18(12-15)26-2)13-22-20-16-6-3-4-7-17(16)23-21(24-20)19-8-5-11-27-19/h3-12H,13H2,1-2H3,(H,22,23,24) |
| InChIKey | NRWBRMBYFYENGB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |