C21H17Cl2N3S — CID 91964768
2-benzyl-N-(2,5-dichlorophenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 91964768) has the molecular formula C21H17Cl2N3S and a molecular weight of 414.36 g/mol. Its IUPAC name is 2-benzyl-N-(2,5-dichlorophenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-benzyl-N-(2,5-dichlorophenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91964768 |
| Molecular Formula | C21H17Cl2N3S |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 2-benzyl-N-(2,5-dichlorophenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(Nc3cc(Cl)ccc3Cl)nc(Cc3ccccc3)nc2s1 |
| InChI | InChI=1S/C21H17Cl2N3S/c1-2-15-12-16-20(24-18-11-14(22)8-9-17(18)23)25-19(26-21(16)27-15)10-13-6-4-3-5-7-13/h3-9,11-12H,2,10H2,1H3,(H,24,25,26) |
| InChIKey | SQWVIRNUCMUPJS-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |