C18H21N3S — CID 91965023
2-benzyl-N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 91965023) has the molecular formula C18H21N3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 2-benzyl-N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-benzyl-N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91965023 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-benzyl-N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCN(CC)c1nc(Cc2ccccc2)nc2sc(C)cc12 |
| InChI | InChI=1S/C18H21N3S/c1-4-21(5-2)17-15-11-13(3)22-18(15)20-16(19-17)12-14-9-7-6-8-10-14/h6-11H,4-5,12H2,1-3H3 |
| InChIKey | JIHVBSCCUJTFOY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |