C17H21N5O3 — CID 91968843
furan-2-yl-[4-(5-morpholin-4-ylpyridazin-3-yl)piperazin-1-yl]methanone (PubChem CID 91968843) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is furan-2-yl-[4-(5-morpholin-4-ylpyridazin-3-yl)piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-(5-morpholin-4-ylpyridazin-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 91968843 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | furan-2-yl-[4-(5-morpholin-4-ylpyridazin-3-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCN(c2cc(N3CCOCC3)cnn2)CC1 |
| InChI | InChI=1S/C17H21N5O3/c23-17(15-2-1-9-25-15)22-5-3-21(4-6-22)16-12-14(13-18-19-16)20-7-10-24-11-8-20/h1-2,9,12-13H,3-8,10-11H2 |
| InChIKey | GCEATZQMWGWRIT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |