C18H21ClFN5O — CID 91969367
2-chloro-N-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]-6-fluorobenzamide (PubChem CID 91969367) has the molecular formula C18H21ClFN5O and a molecular weight of 377.85 g/mol. Its IUPAC name is 2-chloro-N-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 91969367 |
| Molecular Formula | C18H21ClFN5O |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-chloro-N-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]-6-fluorobenzamide |
| SMILES | CN(C)c1nc(N2CCCCC2)ncc1NC(=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C18H21ClFN5O/c1-24(2)16-14(11-21-18(23-16)25-9-4-3-5-10-25)22-17(26)15-12(19)7-6-8-13(15)20/h6-8,11H,3-5,9-10H2,1-2H3,(H,22,26) |
| InChIKey | ZYZRIOPDAHILFW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |