C12H11NO2S2 — CID 91969573
4-[(3-methyl-2-sulfanylidene-1,3-thiazol-5-yl)methyl]benzoic acid (PubChem CID 91969573) has the molecular formula C12H11NO2S2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-[(3-methyl-2-sulfanylidene-1,3-thiazol-5-yl)methyl]benzoic acid.
| Compound Name | 4-[(3-methyl-2-sulfanylidene-1,3-thiazol-5-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 91969573 |
| Molecular Formula | C12H11NO2S2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 4-[(3-methyl-2-sulfanylidene-1,3-thiazol-5-yl)methyl]benzoic acid |
| SMILES | Cn1cc(Cc2ccc(C(=O)O)cc2)sc1=S |
| InChI | InChI=1S/C12H11NO2S2/c1-13-7-10(17-12(13)16)6-8-2-4-9(5-3-8)11(14)15/h2-5,7H,6H2,1H3,(H,14,15) |
| InChIKey | XBBZXHQYBCMHML-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|