C23H19ClFN3O3S — CID 91970231
5-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-1-(2-methoxyethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91970231) has the molecular formula C23H19ClFN3O3S and a molecular weight of 471.94 g/mol. Its IUPAC name is 5-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-1-(2-methoxyethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-1-(2-methoxyethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91970231 |
| Molecular Formula | C23H19ClFN3O3S |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 5-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-1-(2-methoxyethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COCCN1C(=O)C(=Cc2cn(Cc3c(F)cccc3Cl)c3ccccc23)C(=O)NC1=S |
| InChI | InChI=1S/C23H19ClFN3O3S/c1-31-10-9-28-22(30)16(21(29)26-23(28)32)11-14-12-27(20-8-3-2-5-15(14)20)13-17-18(24)6-4-7-19(17)25/h2-8,11-12H,9-10,13H2,1H3,(H,26,29,32) |
| InChIKey | GQDINBULKNWSMK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|