About 5-fluoro-2-[[(2E)-4-octoxyhepta-2,6-dienoyl]amino]benzoic acid
5-fluoro-2-[[(2E)-4-octoxyhepta-2,6-dienoyl]amino]benzoic acid (PubChem CID 91970404) has the molecular formula C22H30FNO4
and a molecular weight of 391.48 g/mol. Its IUPAC name is 5-fluoro-2-[[(2E)-4-octoxyhepta-2,6-dienoyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 5-fluoro-2-[[(2E)-4-octoxyhepta-2,6-dienoyl]amino]benzoic acid |
| PubChem CID | 91970404 |
| Molecular Formula | C22H30FNO4 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 5-fluoro-2-[[(2E)-4-octoxyhepta-2,6-dienoyl]amino]benzoic acid |
| SMILES | C=CCC(/C=C/C(=O)Nc1ccc(F)cc1C(=O)O)OCCCCCCCC |
| InChI | InChI=1S/C22H30FNO4/c1-3-5-6-7-8-9-15-28-18(10-4-2)12-14-21(25)24-20-13-11-17(23)16-19(20)22(26)27/h4,11-14,16,18H,2-3,5-10,15H2,1H3,(H,24,25)(H,26,27)/b14-12+ |
| InChIKey | AFIJSKZSKGWIKO-WYMLVPIESA-N |
| XLogP | 5.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-[[(2E)-4-octoxyhepta-2,6-dienoyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-[[(2E)-4-octoxyhepta-2,6-dienoyl]amino]benzoic acid?
The IUPAC name of 5-fluoro-2-[[(2E)-4-octoxyhepta-2,6-dienoyl]amino]benzoic acid (CID 91970404) is 5-fluoro-2-[[(2E)-4-octoxyhepta-2,6-dienoyl]amino]benzoic acid.
What is the SMILES notation for 5-fluoro-2-[[(2E)-4-octoxyhepta-2,6-dienoyl]amino]benzoic acid?
The canonical SMILES for 5-fluoro-2-[[(2E)-4-octoxyhepta-2,6-dienoyl]amino]benzoic acid is C=CCC(/C=C/C(=O)Nc1ccc(F)cc1C(=O)O)OCCCCCCCC.
What is the InChIKey of 5-fluoro-2-[[(2E)-4-octoxyhepta-2,6-dienoyl]amino]benzoic acid?
The InChIKey is AFIJSKZSKGWIKO-WYMLVPIESA-N. The full InChI is InChI=1S/C22H30FNO4/c1-3-5-6-7-8-9-15-28-18(10-4-2)12-14-21(25)24-20-13-11-17(23)16-19(20)22(26)27/h4,11-14,16,18H,2-3,5-10,15H2,1H3,(H,24,25)(H,26,27)/b14-12+.
What are the key properties of 5-fluoro-2-[[(2E)-4-octoxyhepta-2,6-dienoyl]amino]benzoic acid?
5-fluoro-2-[[(2E)-4-octoxyhepta-2,6-dienoyl]amino]benzoic acid has a molecular weight of 391.48 g/mol, XLogP of 5.34, 14 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-[[(2E)-4-octoxyhepta-2,6-dienoyl]amino]benzoic acid is sourced from PubChem (CID 91970404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).