C32H38N4O2 — CID 91970511
2-[4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]phenyl]-3-phenyl-2,3,4,4a,6,7,8,8a-octahydro-1H-1,6-naphthyridin-5-one (PubChem CID 91970511) has the molecular formula C32H38N4O2 and a molecular weight of 510.68 g/mol. Its IUPAC name is 2-[4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]phenyl]-3-phenyl-2,3,4,4a,6,7,8,8a-octahydro-1H-1,6-naphthyridin-5-one.
| Compound Name | 2-[4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]phenyl]-3-phenyl-2,3,4,4a,6,7,8,8a-octahydro-1H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 91970511 |
| Molecular Formula | C32H38N4O2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | 2-[4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]phenyl]-3-phenyl-2,3,4,4a,6,7,8,8a-octahydro-1H-1,6-naphthyridin-5-one |
| SMILES | COc1ccc(N2CCN(Cc3ccc(C4NC5CCNC(=O)C5CC4c4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H38N4O2/c1-38-27-13-11-26(12-14-27)36-19-17-35(18-20-36)22-23-7-9-25(10-8-23)31-28(24-5-3-2-4-6-24)21-29-30(34-31)15-16-33-32(29)37/h2-14,28-31,34H,15-22H2,1H3,(H,33,37) |
| InChIKey | YVXHRHJBKUZHTH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|